C15H22N6S — CID 97460123
2-[[(2S,3aR,7aS)-1-methyl-2-(1,2,4-triazol-1-ylmethyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-5-yl]methyl]-1,3-thiazole (PubChem CID 97460123) has the molecular formula C15H22N6S and a molecular weight of 318.45 g/mol. Its IUPAC name is 2-[[(2S,3aR,7aS)-1-methyl-2-(1,2,4-triazol-1-ylmethyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-5-yl]methyl]-1,3-thiazole.
| Compound Name | 2-[[(2S,3aR,7aS)-1-methyl-2-(1,2,4-triazol-1-ylmethyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-5-yl]methyl]-1,3-thiazole |
|---|---|
| PubChem CID | 97460123 |
| Molecular Formula | C15H22N6S |
| Molecular Weight | 318.45 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | 2-[[(2S,3aR,7aS)-1-methyl-2-(1,2,4-triazol-1-ylmethyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-5-yl]methyl]-1,3-thiazole |
| SMILES | CN1[C@H](Cn2cncn2)C[C@@H]2CN(Cc3nccs3)CC[C@@H]21 |
| InChI | InChI=1S/C15H22N6S/c1-19-13(8-21-11-16-10-18-21)6-12-7-20(4-2-14(12)19)9-15-17-3-5-22-15/h3,5,10-14H,2,4,6-9H2,1H3/t12-,13+,14+/m1/s1 |
| InChIKey | DXPCACLANUDGHN-RDBSUJKOSA-N |
| XLogP | 1.33 |
| TPSA | 50.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.45 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |