C16H25N5O — CID 97460166
1-[(2S,3aR,7aS)-5-(cyclopropylmethyl)-2-(1,2,4-triazol-1-ylmethyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]ethanone (PubChem CID 97460166) has the molecular formula C16H25N5O and a molecular weight of 303.41 g/mol. Its IUPAC name is 1-[(2S,3aR,7aS)-5-(cyclopropylmethyl)-2-(1,2,4-triazol-1-ylmethyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]ethanone.
| Compound Name | 1-[(2S,3aR,7aS)-5-(cyclopropylmethyl)-2-(1,2,4-triazol-1-ylmethyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]ethanone |
|---|---|
| PubChem CID | 97460166 |
| Molecular Formula | C16H25N5O |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.21 |
| IUPAC Name | 1-[(2S,3aR,7aS)-5-(cyclopropylmethyl)-2-(1,2,4-triazol-1-ylmethyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]ethanone |
| SMILES | CC(=O)N1[C@H](Cn2cncn2)C[C@@H]2CN(CC3CC3)CC[C@@H]21 |
| InChI | InChI=1S/C16H25N5O/c1-12(22)21-15(9-20-11-17-10-18-20)6-14-8-19(5-4-16(14)21)7-13-2-3-13/h10-11,13-16H,2-9H2,1H3/t14-,15+,16+/m1/s1 |
| InChIKey | YVAYEPSAJZGNIE-PMPSAXMXSA-N |
| XLogP | 1.00 |
| TPSA | 54.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |