C16H24N6S — CID 97460178
2-[(2S,3aR,7aS)-5-propan-2-yl-2-(1,2,4-triazol-1-ylmethyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]-1,3-thiazole (PubChem CID 97460178) has the molecular formula C16H24N6S and a molecular weight of 332.48 g/mol. Its IUPAC name is 2-[(2S,3aR,7aS)-5-propan-2-yl-2-(1,2,4-triazol-1-ylmethyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]-1,3-thiazole.
| Compound Name | 2-[(2S,3aR,7aS)-5-propan-2-yl-2-(1,2,4-triazol-1-ylmethyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]-1,3-thiazole |
|---|---|
| PubChem CID | 97460178 |
| Molecular Formula | C16H24N6S |
| Molecular Weight | 332.48 g/mol |
| Exact Mass | 332.18 |
| IUPAC Name | 2-[(2S,3aR,7aS)-5-propan-2-yl-2-(1,2,4-triazol-1-ylmethyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]-1,3-thiazole |
| SMILES | CC(C)N1CC[C@H]2[C@H](C[C@@H](Cn3cncn3)N2c2nccs2)C1 |
| InChI | InChI=1S/C16H24N6S/c1-12(2)20-5-3-15-13(8-20)7-14(9-21-11-17-10-19-21)22(15)16-18-4-6-23-16/h4,6,10-15H,3,5,7-9H2,1-2H3/t13-,14+,15+/m1/s1 |
| InChIKey | BCOBOECHYTWNJW-ILXRZTDVSA-N |
| XLogP | 2.11 |
| TPSA | 50.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.48 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |