C15H20N6OS — CID 97460179
1-[(2S,3aR,7aS)-1-(1,3-thiazol-2-yl)-2-(1,2,4-triazol-1-ylmethyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-5-yl]ethanone (PubChem CID 97460179) has the molecular formula C15H20N6OS and a molecular weight of 332.43 g/mol. Its IUPAC name is 1-[(2S,3aR,7aS)-1-(1,3-thiazol-2-yl)-2-(1,2,4-triazol-1-ylmethyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-5-yl]ethanone.
| Compound Name | 1-[(2S,3aR,7aS)-1-(1,3-thiazol-2-yl)-2-(1,2,4-triazol-1-ylmethyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-5-yl]ethanone |
|---|---|
| PubChem CID | 97460179 |
| Molecular Formula | C15H20N6OS |
| Molecular Weight | 332.43 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | 1-[(2S,3aR,7aS)-1-(1,3-thiazol-2-yl)-2-(1,2,4-triazol-1-ylmethyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-5-yl]ethanone |
| SMILES | CC(=O)N1CC[C@H]2[C@H](C[C@@H](Cn3cncn3)N2c2nccs2)C1 |
| InChI | InChI=1S/C15H20N6OS/c1-11(22)19-4-2-14-12(7-19)6-13(8-20-10-16-9-18-20)21(14)15-17-3-5-23-15/h3,5,9-10,12-14H,2,4,6-8H2,1H3/t12-,13+,14+/m1/s1 |
| InChIKey | DUNQZYXQSKOTBP-RDBSUJKOSA-N |
| XLogP | 1.25 |
| TPSA | 67.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.43 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |