C16H23FN2O3S — CID 97460284
(3R,3aR,7aR)-1-(3-fluoro-4-methylphenyl)sulfonyl-N,N-dimethyl-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-3-amine (PubChem CID 97460284) has the molecular formula C16H23FN2O3S and a molecular weight of 342.44 g/mol. Its IUPAC name is (3R,3aR,7aR)-1-(3-fluoro-4-methylphenyl)sulfonyl-N,N-dimethyl-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-3-amine.
| Compound Name | (3R,3aR,7aR)-1-(3-fluoro-4-methylphenyl)sulfonyl-N,N-dimethyl-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-3-amine |
|---|---|
| PubChem CID | 97460284 |
| Molecular Formula | C16H23FN2O3S |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | (3R,3aR,7aR)-1-(3-fluoro-4-methylphenyl)sulfonyl-N,N-dimethyl-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-3-amine |
| SMILES | Cc1ccc(S(=O)(=O)N2C[C@@H](N(C)C)[C@H]3OCCC[C@H]32)cc1F |
| InChI | InChI=1S/C16H23FN2O3S/c1-11-6-7-12(9-13(11)17)23(20,21)19-10-15(18(2)3)16-14(19)5-4-8-22-16/h6-7,9,14-16H,4-5,8,10H2,1-3H3/t14-,15-,16+/m1/s1 |
| InChIKey | BFRCZEMNJBLECS-OAGGEKHMSA-N |
| XLogP | 1.62 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |