C18H22N4O3 — CID 97460510
[(3R,3aS,7aR)-3-[methyl(pyridin-3-ylmethyl)amino]-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-1-yl]-(1,2-oxazol-5-yl)methanone (PubChem CID 97460510) has the molecular formula C18H22N4O3 and a molecular weight of 342.40 g/mol. Its IUPAC name is [(3R,3aS,7aR)-3-[methyl(pyridin-3-ylmethyl)amino]-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-1-yl]-(1,2-oxazol-5-yl)methanone.
| Compound Name | [(3R,3aS,7aR)-3-[methyl(pyridin-3-ylmethyl)amino]-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-1-yl]-(1,2-oxazol-5-yl)methanone |
|---|---|
| PubChem CID | 97460510 |
| Molecular Formula | C18H22N4O3 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | [(3R,3aS,7aR)-3-[methyl(pyridin-3-ylmethyl)amino]-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-1-yl]-(1,2-oxazol-5-yl)methanone |
| SMILES | CN(Cc1cccnc1)[C@@H]1CN(C(=O)c2ccno2)[C@@H]2CCCO[C@H]12 |
| InChI | InChI=1S/C18H22N4O3/c1-21(11-13-4-2-7-19-10-13)15-12-22(14-5-3-9-24-17(14)15)18(23)16-6-8-20-25-16/h2,4,6-8,10,14-15,17H,3,5,9,11-12H2,1H3/t14-,15-,17+/m1/s1 |
| InChIKey | UKGOYIPBAZDRMC-INMHGKMJSA-N |
| XLogP | 1.57 |
| TPSA | 71.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |