C17H22N4O2S — CID 97460645
(3aS,5S,7aS)-5-[(2-methyl-1,3-thiazol-4-yl)methoxymethyl]-1-pyrimidin-2-yl-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole (PubChem CID 97460645) has the molecular formula C17H22N4O2S and a molecular weight of 346.46 g/mol. Its IUPAC name is (3aS,5S,7aS)-5-[(2-methyl-1,3-thiazol-4-yl)methoxymethyl]-1-pyrimidin-2-yl-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole.
| Compound Name | (3aS,5S,7aS)-5-[(2-methyl-1,3-thiazol-4-yl)methoxymethyl]-1-pyrimidin-2-yl-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole |
|---|---|
| PubChem CID | 97460645 |
| Molecular Formula | C17H22N4O2S |
| Molecular Weight | 346.46 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | (3aS,5S,7aS)-5-[(2-methyl-1,3-thiazol-4-yl)methoxymethyl]-1-pyrimidin-2-yl-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole |
| SMILES | Cc1nc(COC[C@@H]2CC[C@H]3[C@H](CCN3c3ncccn3)O2)cs1 |
| InChI | InChI=1S/C17H22N4O2S/c1-12-20-13(11-24-12)9-22-10-14-3-4-15-16(23-14)5-8-21(15)17-18-6-2-7-19-17/h2,6-7,11,14-16H,3-5,8-10H2,1H3/t14-,15-,16-/m0/s1 |
| InChIKey | KYPVKKRIMNIYQG-JYJNAYRXSA-N |
| XLogP | 2.58 |
| TPSA | 60.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.46 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |