C17H23FN4O2 — CID 97460835
(3aS,7aS)-1-(5-fluoropyrimidin-2-yl)-4-(oxan-4-ylmethyl)-2,3,3a,6,7,7a-hexahydropyrrolo[3,2-b]pyridin-5-one (PubChem CID 97460835) has the molecular formula C17H23FN4O2 and a molecular weight of 334.40 g/mol. Its IUPAC name is (3aS,7aS)-1-(5-fluoropyrimidin-2-yl)-4-(oxan-4-ylmethyl)-2,3,3a,6,7,7a-hexahydropyrrolo[3,2-b]pyridin-5-one.
| Compound Name | (3aS,7aS)-1-(5-fluoropyrimidin-2-yl)-4-(oxan-4-ylmethyl)-2,3,3a,6,7,7a-hexahydropyrrolo[3,2-b]pyridin-5-one |
|---|---|
| PubChem CID | 97460835 |
| Molecular Formula | C17H23FN4O2 |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | (3aS,7aS)-1-(5-fluoropyrimidin-2-yl)-4-(oxan-4-ylmethyl)-2,3,3a,6,7,7a-hexahydropyrrolo[3,2-b]pyridin-5-one |
| SMILES | O=C1CC[C@H]2[C@H](CCN2c2ncc(F)cn2)N1CC1CCOCC1 |
| InChI | InChI=1S/C17H23FN4O2/c18-13-9-19-17(20-10-13)21-6-3-15-14(21)1-2-16(23)22(15)11-12-4-7-24-8-5-12/h9-10,12,14-15H,1-8,11H2/t14-,15-/m0/s1 |
| InChIKey | XAEYHZYICKXMCJ-GJZGRUSLSA-N |
| XLogP | 1.61 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |