C15H21N3O3S — CID 97461064
[(2S,3aS,6aS)-4-(1,3-thiazol-2-ylmethyl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrol-2-yl]-morpholin-4-ylmethanone (PubChem CID 97461064) has the molecular formula C15H21N3O3S and a molecular weight of 323.42 g/mol. Its IUPAC name is [(2S,3aS,6aS)-4-(1,3-thiazol-2-ylmethyl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrol-2-yl]-morpholin-4-ylmethanone.
| Compound Name | [(2S,3aS,6aS)-4-(1,3-thiazol-2-ylmethyl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrol-2-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 97461064 |
| Molecular Formula | C15H21N3O3S |
| Molecular Weight | 323.42 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | [(2S,3aS,6aS)-4-(1,3-thiazol-2-ylmethyl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrol-2-yl]-morpholin-4-ylmethanone |
| SMILES | O=C([C@@H]1C[C@H]2[C@H](CCN2Cc2nccs2)O1)N1CCOCC1 |
| InChI | InChI=1S/C15H21N3O3S/c19-15(17-4-6-20-7-5-17)13-9-11-12(21-13)1-3-18(11)10-14-16-2-8-22-14/h2,8,11-13H,1,3-7,9-10H2/t11-,12-,13-/m0/s1 |
| InChIKey | DUQKHAPVXHXTJJ-AVGNSLFASA-N |
| XLogP | 0.73 |
| TPSA | 54.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.42 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |