C20H25N3O2 — CID 97461275
(3aS,5R,7aS)-5-(pyridin-2-ylmethoxymethyl)-1-(pyridin-3-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole (PubChem CID 97461275) has the molecular formula C20H25N3O2 and a molecular weight of 339.44 g/mol. Its IUPAC name is (3aS,5R,7aS)-5-(pyridin-2-ylmethoxymethyl)-1-(pyridin-3-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole.
| Compound Name | (3aS,5R,7aS)-5-(pyridin-2-ylmethoxymethyl)-1-(pyridin-3-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole |
|---|---|
| PubChem CID | 97461275 |
| Molecular Formula | C20H25N3O2 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.19 |
| IUPAC Name | (3aS,5R,7aS)-5-(pyridin-2-ylmethoxymethyl)-1-(pyridin-3-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole |
| SMILES | c1ccc(COC[C@H]2CC[C@H]3[C@H](CCN3Cc3cccnc3)O2)nc1 |
| InChI | InChI=1S/C20H25N3O2/c1-2-10-22-17(5-1)14-24-15-18-6-7-19-20(25-18)8-11-23(19)13-16-4-3-9-21-12-16/h1-5,9-10,12,18-20H,6-8,11,13-15H2/t18-,19+,20+/m1/s1 |
| InChIKey | ORAFTGIEBWRUPO-AABGKKOBSA-N |
| XLogP | 2.82 |
| TPSA | 47.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |