C16H28N4O — CID 97461293
(3aS,7R,7aR)-N,N-diethyl-2-[(1-methylpyrazol-4-yl)methyl]-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrol-7-amine (PubChem CID 97461293) has the molecular formula C16H28N4O and a molecular weight of 292.43 g/mol. Its IUPAC name is (3aS,7R,7aR)-N,N-diethyl-2-[(1-methylpyrazol-4-yl)methyl]-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrol-7-amine.
| Compound Name | (3aS,7R,7aR)-N,N-diethyl-2-[(1-methylpyrazol-4-yl)methyl]-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrol-7-amine |
|---|---|
| PubChem CID | 97461293 |
| Molecular Formula | C16H28N4O |
| Molecular Weight | 292.43 g/mol |
| Exact Mass | 292.23 |
| IUPAC Name | (3aS,7R,7aR)-N,N-diethyl-2-[(1-methylpyrazol-4-yl)methyl]-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrol-7-amine |
| SMILES | CCN(CC)[C@H]1COC[C@@H]2CN(Cc3cnn(C)c3)C[C@@H]21 |
| InChI | InChI=1S/C16H28N4O/c1-4-20(5-2)16-12-21-11-14-9-19(10-15(14)16)8-13-6-17-18(3)7-13/h6-7,14-16H,4-5,8-12H2,1-3H3/t14-,15-,16-/m0/s1 |
| InChIKey | USNLQJNMCUPXHZ-JYJNAYRXSA-N |
| XLogP | 1.21 |
| TPSA | 33.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.43 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |