C17H25N3O3 — CID 97461562
(3S,3aS,7aR)-3-(oxan-4-ylmethoxy)-1-pyrimidin-4-yl-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole (PubChem CID 97461562) has the molecular formula C17H25N3O3 and a molecular weight of 319.40 g/mol. Its IUPAC name is (3S,3aS,7aR)-3-(oxan-4-ylmethoxy)-1-pyrimidin-4-yl-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole.
| Compound Name | (3S,3aS,7aR)-3-(oxan-4-ylmethoxy)-1-pyrimidin-4-yl-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole |
|---|---|
| PubChem CID | 97461562 |
| Molecular Formula | C17H25N3O3 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.19 |
| IUPAC Name | (3S,3aS,7aR)-3-(oxan-4-ylmethoxy)-1-pyrimidin-4-yl-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole |
| SMILES | c1cc(N2C[C@H](OCC3CCOCC3)[C@H]3OCCC[C@H]32)ncn1 |
| InChI | InChI=1S/C17H25N3O3/c1-2-14-17(22-7-1)15(23-11-13-4-8-21-9-5-13)10-20(14)16-3-6-18-12-19-16/h3,6,12-15,17H,1-2,4-5,7-11H2/t14-,15+,17+/m1/s1 |
| InChIKey | PAZVBDVCQMFFSH-VYDXJSESSA-N |
| XLogP | 1.66 |
| TPSA | 56.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |