C19H26N2O3 — CID 97461586
1-[(3S,3aS,7aR)-3-pyridin-3-yloxy-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-1-yl]-2-cyclopentylethanone (PubChem CID 97461586) has the molecular formula C19H26N2O3 and a molecular weight of 330.43 g/mol. Its IUPAC name is 1-[(3S,3aS,7aR)-3-pyridin-3-yloxy-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-1-yl]-2-cyclopentylethanone.
| Compound Name | 1-[(3S,3aS,7aR)-3-pyridin-3-yloxy-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-1-yl]-2-cyclopentylethanone |
|---|---|
| PubChem CID | 97461586 |
| Molecular Formula | C19H26N2O3 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | 1-[(3S,3aS,7aR)-3-pyridin-3-yloxy-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-1-yl]-2-cyclopentylethanone |
| SMILES | O=C(CC1CCCC1)N1C[C@H](Oc2cccnc2)[C@H]2OCCC[C@H]21 |
| InChI | InChI=1S/C19H26N2O3/c22-18(11-14-5-1-2-6-14)21-13-17(19-16(21)8-4-10-23-19)24-15-7-3-9-20-12-15/h3,7,9,12,14,16-17,19H,1-2,4-6,8,10-11,13H2/t16-,17+,19+/m1/s1 |
| InChIKey | OBVMNMPQOHGTRE-AOIWGVFYSA-N |
| XLogP | 2.80 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |