C12H21N3O3 — CID 97461724
(3aR,5R,7aR)-1-N,1-N,5-N-trimethyl-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-1,5-dicarboxamide (PubChem CID 97461724) has the molecular formula C12H21N3O3 and a molecular weight of 255.32 g/mol. Its IUPAC name is (3aR,5R,7aR)-1-N,1-N,5-N-trimethyl-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-1,5-dicarboxamide.
| Compound Name | (3aR,5R,7aR)-1-N,1-N,5-N-trimethyl-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-1,5-dicarboxamide |
|---|---|
| PubChem CID | 97461724 |
| Molecular Formula | C12H21N3O3 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.16 |
| IUPAC Name | (3aR,5R,7aR)-1-N,1-N,5-N-trimethyl-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-1,5-dicarboxamide |
| SMILES | CNC(=O)[C@H]1CC[C@@H]2[C@@H](CCN2C(=O)N(C)C)O1 |
| InChI | InChI=1S/C12H21N3O3/c1-13-11(16)10-5-4-8-9(18-10)6-7-15(8)12(17)14(2)3/h8-10H,4-7H2,1-3H3,(H,13,16)/t8-,9-,10-/m1/s1 |
| InChIKey | QETZPOGXMNSSPT-OPRDCNLKSA-N |
| XLogP | 0.04 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |