C14H20N4OS — CID 97462200
4-[[(6S)-6-(methoxymethyl)-5,6,7,9-tetrahydroimidazo[1,2-a][1,4]diazepin-8-yl]methyl]-2-methyl-1,3-thiazole (PubChem CID 97462200) has the molecular formula C14H20N4OS and a molecular weight of 292.41 g/mol. Its IUPAC name is 4-[[(6S)-6-(methoxymethyl)-5,6,7,9-tetrahydroimidazo[1,2-a][1,4]diazepin-8-yl]methyl]-2-methyl-1,3-thiazole.
| Compound Name | 4-[[(6S)-6-(methoxymethyl)-5,6,7,9-tetrahydroimidazo[1,2-a][1,4]diazepin-8-yl]methyl]-2-methyl-1,3-thiazole |
|---|---|
| PubChem CID | 97462200 |
| Molecular Formula | C14H20N4OS |
| Molecular Weight | 292.41 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | 4-[[(6S)-6-(methoxymethyl)-5,6,7,9-tetrahydroimidazo[1,2-a][1,4]diazepin-8-yl]methyl]-2-methyl-1,3-thiazole |
| SMILES | COC[C@H]1CN(Cc2csc(C)n2)Cc2nccn2C1 |
| InChI | InChI=1S/C14H20N4OS/c1-11-16-13(10-20-11)7-17-5-12(9-19-2)6-18-4-3-15-14(18)8-17/h3-4,10,12H,5-9H2,1-2H3/t12-/m0/s1 |
| InChIKey | WSSHIVCKQIQNQF-LBPRGKRZSA-N |
| XLogP | 1.93 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.41 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |