C16H21N3O2 — CID 97462278
(6R)-8-(furan-2-ylmethyl)-6-(prop-2-enoxymethyl)-5,6,7,9-tetrahydroimidazo[1,2-a][1,4]diazepine (PubChem CID 97462278) has the molecular formula C16H21N3O2 and a molecular weight of 287.36 g/mol. Its IUPAC name is (6R)-8-(furan-2-ylmethyl)-6-(prop-2-enoxymethyl)-5,6,7,9-tetrahydroimidazo[1,2-a][1,4]diazepine.
| Compound Name | (6R)-8-(furan-2-ylmethyl)-6-(prop-2-enoxymethyl)-5,6,7,9-tetrahydroimidazo[1,2-a][1,4]diazepine |
|---|---|
| PubChem CID | 97462278 |
| Molecular Formula | C16H21N3O2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | (6R)-8-(furan-2-ylmethyl)-6-(prop-2-enoxymethyl)-5,6,7,9-tetrahydroimidazo[1,2-a][1,4]diazepine |
| SMILES | C=CCOC[C@@H]1CN(Cc2ccco2)Cc2nccn2C1 |
| InChI | InChI=1S/C16H21N3O2/c1-2-7-20-13-14-9-18(11-15-4-3-8-21-15)12-16-17-5-6-19(16)10-14/h2-6,8,14H,1,7,9-13H2/t14-/m1/s1 |
| InChIKey | KHQCWFWAGSITTJ-CQSZACIVSA-N |
| XLogP | 2.31 |
| TPSA | 43.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|