C17H20N6O2 — CID 97463144
[(6S)-6-[(3,5-dimethyl-1,2,4-triazol-1-yl)methyl]-5,6,7,9-tetrahydroimidazo[1,2-a][1,4]diazepin-8-yl]-(furan-2-yl)methanone (PubChem CID 97463144) has the molecular formula C17H20N6O2 and a molecular weight of 340.39 g/mol. Its IUPAC name is [(6S)-6-[(3,5-dimethyl-1,2,4-triazol-1-yl)methyl]-5,6,7,9-tetrahydroimidazo[1,2-a][1,4]diazepin-8-yl]-(furan-2-yl)methanone.
| Compound Name | [(6S)-6-[(3,5-dimethyl-1,2,4-triazol-1-yl)methyl]-5,6,7,9-tetrahydroimidazo[1,2-a][1,4]diazepin-8-yl]-(furan-2-yl)methanone |
|---|---|
| PubChem CID | 97463144 |
| Molecular Formula | C17H20N6O2 |
| Molecular Weight | 340.39 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | [(6S)-6-[(3,5-dimethyl-1,2,4-triazol-1-yl)methyl]-5,6,7,9-tetrahydroimidazo[1,2-a][1,4]diazepin-8-yl]-(furan-2-yl)methanone |
| SMILES | Cc1nc(C)n(C[C@@H]2CN(C(=O)c3ccco3)Cc3nccn3C2)n1 |
| InChI | InChI=1S/C17H20N6O2/c1-12-19-13(2)23(20-12)10-14-8-21-6-5-18-16(21)11-22(9-14)17(24)15-4-3-7-25-15/h3-7,14H,8-11H2,1-2H3/t14-/m0/s1 |
| InChIKey | YTSBLPBBMNIAPO-AWEZNQCLSA-N |
| XLogP | 1.66 |
| TPSA | 81.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.39 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |