C18H20N2O3S — CID 97464341
(Z)-N-(2,3-dihydro-1,4-benzodioxin-5-ylmethyl)-N-ethyl-3-(2-methyl-1,3-thiazol-4-yl)prop-2-enamide (PubChem CID 97464341) has the molecular formula C18H20N2O3S and a molecular weight of 344.44 g/mol. Its IUPAC name is (Z)-N-(2,3-dihydro-1,4-benzodioxin-5-ylmethyl)-N-ethyl-3-(2-methyl-1,3-thiazol-4-yl)prop-2-enamide.
| Compound Name | (Z)-N-(2,3-dihydro-1,4-benzodioxin-5-ylmethyl)-N-ethyl-3-(2-methyl-1,3-thiazol-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 97464341 |
| Molecular Formula | C18H20N2O3S |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | (Z)-N-(2,3-dihydro-1,4-benzodioxin-5-ylmethyl)-N-ethyl-3-(2-methyl-1,3-thiazol-4-yl)prop-2-enamide |
| SMILES | CCN(Cc1cccc2c1OCCO2)C(=O)/C=C\c1csc(C)n1 |
| InChI | InChI=1S/C18H20N2O3S/c1-3-20(17(21)8-7-15-12-24-13(2)19-15)11-14-5-4-6-16-18(14)23-10-9-22-16/h4-8,12H,3,9-11H2,1-2H3/b8-7- |
| InChIKey | PRUJPAITXGSOCA-FPLPWBNLSA-N |
| XLogP | 3.28 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|