C30H63NO3 — CID 97464992
2-[(2S)-2-ethylhexoxy]-N,N-bis[2-[(2S)-2-ethylhexoxy]ethyl]ethanamine (PubChem CID 97464992) has the molecular formula C30H63NO3 and a molecular weight of 485.84 g/mol. Its IUPAC name is 2-[(2S)-2-ethylhexoxy]-N,N-bis[2-[(2S)-2-ethylhexoxy]ethyl]ethanamine.
| Compound Name | 2-[(2S)-2-ethylhexoxy]-N,N-bis[2-[(2S)-2-ethylhexoxy]ethyl]ethanamine |
|---|---|
| PubChem CID | 97464992 |
| Molecular Formula | C30H63NO3 |
| Molecular Weight | 485.84 g/mol |
| Exact Mass | 485.48 |
| IUPAC Name | 2-[(2S)-2-ethylhexoxy]-N,N-bis[2-[(2S)-2-ethylhexoxy]ethyl]ethanamine |
| SMILES | CCCC[C@H](CC)COCCN(CCOC[C@@H](CC)CCCC)CCOC[C@@H](CC)CCCC |
| InChI | InChI=1S/C30H63NO3/c1-7-13-16-28(10-4)25-32-22-19-31(20-23-33-26-29(11-5)17-14-8-2)21-24-34-27-30(12-6)18-15-9-3/h28-30H,7-27H2,1-6H3/t28-,29-,30-/m0/s1 |
| InChIKey | IUPZQZJVXNSYNP-DTXPUJKBSA-N |
| XLogP | 7.99 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.84 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|