C16H26N4O2 — CID 97465114
(3R)-N-butyl-1-[1-(2-methylpropyl)pyrazol-4-yl]-5-oxopyrrolidine-3-carboxamide (PubChem CID 97465114) has the molecular formula C16H26N4O2 and a molecular weight of 306.41 g/mol. Its IUPAC name is (3R)-N-butyl-1-[1-(2-methylpropyl)pyrazol-4-yl]-5-oxopyrrolidine-3-carboxamide.
| Compound Name | (3R)-N-butyl-1-[1-(2-methylpropyl)pyrazol-4-yl]-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 97465114 |
| Molecular Formula | C16H26N4O2 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.21 |
| IUPAC Name | (3R)-N-butyl-1-[1-(2-methylpropyl)pyrazol-4-yl]-5-oxopyrrolidine-3-carboxamide |
| SMILES | CCCCNC(=O)[C@@H]1CC(=O)N(c2cnn(CC(C)C)c2)C1 |
| InChI | InChI=1S/C16H26N4O2/c1-4-5-6-17-16(22)13-7-15(21)20(10-13)14-8-18-19(11-14)9-12(2)3/h8,11-13H,4-7,9-10H2,1-3H3,(H,17,22)/t13-/m1/s1 |
| InChIKey | LSZSMFWTQKUUFG-CYBMUJFWSA-N |
| XLogP | 1.81 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|