C14H16N4O3 — CID 97465205
(3R)-N-(furan-2-ylmethyl)-1-(1-methylpyrazol-4-yl)-5-oxopyrrolidine-3-carboxamide (PubChem CID 97465205) has the molecular formula C14H16N4O3 and a molecular weight of 288.31 g/mol. Its IUPAC name is (3R)-N-(furan-2-ylmethyl)-1-(1-methylpyrazol-4-yl)-5-oxopyrrolidine-3-carboxamide.
| Compound Name | (3R)-N-(furan-2-ylmethyl)-1-(1-methylpyrazol-4-yl)-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 97465205 |
| Molecular Formula | C14H16N4O3 |
| Molecular Weight | 288.31 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | (3R)-N-(furan-2-ylmethyl)-1-(1-methylpyrazol-4-yl)-5-oxopyrrolidine-3-carboxamide |
| SMILES | Cn1cc(N2C[C@H](C(=O)NCc3ccco3)CC2=O)cn1 |
| InChI | InChI=1S/C14H16N4O3/c1-17-9-11(6-16-17)18-8-10(5-13(18)19)14(20)15-7-12-3-2-4-21-12/h2-4,6,9-10H,5,7-8H2,1H3,(H,15,20)/t10-/m1/s1 |
| InChIKey | ITILERFUDGSDIW-SNVBAGLBSA-N |
| XLogP | 0.68 |
| TPSA | 80.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.31 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |