About (5R)-N-(2,5-dimethylpyrazol-3-yl)-3-(2-methoxyphenyl)-5-methyl-4H-1,2-oxazole-5-carboxamide
(5R)-N-(2,5-dimethylpyrazol-3-yl)-3-(2-methoxyphenyl)-5-methyl-4H-1,2-oxazole-5-carboxamide (PubChem CID 97465787) has the molecular formula C17H20N4O3
and a molecular weight of 328.37 g/mol. Its IUPAC name is (5R)-N-(2,5-dimethylpyrazol-3-yl)-3-(2-methoxyphenyl)-5-methyl-4H-1,2-oxazole-5-carboxamide.
Molecular Properties
| Compound Name | (5R)-N-(2,5-dimethylpyrazol-3-yl)-3-(2-methoxyphenyl)-5-methyl-4H-1,2-oxazole-5-carboxamide |
| PubChem CID | 97465787 |
| Molecular Formula | C17H20N4O3 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | (5R)-N-(2,5-dimethylpyrazol-3-yl)-3-(2-methoxyphenyl)-5-methyl-4H-1,2-oxazole-5-carboxamide |
| SMILES | COc1ccccc1C1=NO[C@@](C)(C(=O)Nc2cc(C)nn2C)C1 |
| InChI | InChI=1S/C17H20N4O3/c1-11-9-15(21(3)19-11)18-16(22)17(2)10-13(20-24-17)12-7-5-6-8-14(12)23-4/h5-9H,10H2,1-4H3,(H,18,22)/t17-/m1/s1 |
| InChIKey | KYVDQXWWPIEZLD-QGZVFWFLSA-N |
| XLogP | 2.26 |
| TPSA | 77.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (5R)-N-(2,5-dimethylpyrazol-3-yl)-3-(2-methoxyphenyl)-5-methyl-4H-1,2-oxazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R)-N-(2,5-dimethylpyrazol-3-yl)-3-(2-methoxyphenyl)-5-methyl-4H-1,2-oxazole-5-carboxamide?
The IUPAC name of (5R)-N-(2,5-dimethylpyrazol-3-yl)-3-(2-methoxyphenyl)-5-methyl-4H-1,2-oxazole-5-carboxamide (CID 97465787) is (5R)-N-(2,5-dimethylpyrazol-3-yl)-3-(2-methoxyphenyl)-5-methyl-4H-1,2-oxazole-5-carboxamide.
What is the SMILES notation for (5R)-N-(2,5-dimethylpyrazol-3-yl)-3-(2-methoxyphenyl)-5-methyl-4H-1,2-oxazole-5-carboxamide?
The canonical SMILES for (5R)-N-(2,5-dimethylpyrazol-3-yl)-3-(2-methoxyphenyl)-5-methyl-4H-1,2-oxazole-5-carboxamide is COc1ccccc1C1=NO[C@@](C)(C(=O)Nc2cc(C)nn2C)C1.
What is the InChIKey of (5R)-N-(2,5-dimethylpyrazol-3-yl)-3-(2-methoxyphenyl)-5-methyl-4H-1,2-oxazole-5-carboxamide?
The InChIKey is KYVDQXWWPIEZLD-QGZVFWFLSA-N. The full InChI is InChI=1S/C17H20N4O3/c1-11-9-15(21(3)19-11)18-16(22)17(2)10-13(20-24-17)12-7-5-6-8-14(12)23-4/h5-9H,10H2,1-4H3,(H,18,22)/t17-/m1/s1.
What are the key properties of (5R)-N-(2,5-dimethylpyrazol-3-yl)-3-(2-methoxyphenyl)-5-methyl-4H-1,2-oxazole-5-carboxamide?
(5R)-N-(2,5-dimethylpyrazol-3-yl)-3-(2-methoxyphenyl)-5-methyl-4H-1,2-oxazole-5-carboxamide has a molecular weight of 328.37 g/mol, XLogP of 2.26, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (5R)-N-(2,5-dimethylpyrazol-3-yl)-3-(2-methoxyphenyl)-5-methyl-4H-1,2-oxazole-5-carboxamide is sourced from PubChem (CID 97465787), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).