About 1-(2,5-dimethoxyphenyl)-2,5-dimethylpyrrole-3-carbaldehyde
1-(2,5-dimethoxyphenyl)-2,5-dimethylpyrrole-3-carbaldehyde (PubChem CID 974665) has the molecular formula C15H17NO3
and a molecular weight of 259.31 g/mol. Its IUPAC name is 1-(2,5-dimethoxyphenyl)-2,5-dimethylpyrrole-3-carbaldehyde.
Molecular Properties
| Compound Name | 1-(2,5-dimethoxyphenyl)-2,5-dimethylpyrrole-3-carbaldehyde |
| PubChem CID | 974665 |
| Molecular Formula | C15H17NO3 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | 1-(2,5-dimethoxyphenyl)-2,5-dimethylpyrrole-3-carbaldehyde |
| SMILES | COc1ccc(OC)c(-n2c(C)cc(C=O)c2C)c1 |
| InChI | InChI=1S/C15H17NO3/c1-10-7-12(9-17)11(2)16(10)14-8-13(18-3)5-6-15(14)19-4/h5-9H,1-4H3 |
| InChIKey | RVYUZOBWBARGQJ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 1-(2,5-dimethoxyphenyl)-2,5-dimethylpyrrole-3-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,5-dimethoxyphenyl)-2,5-dimethylpyrrole-3-carbaldehyde?
The IUPAC name of 1-(2,5-dimethoxyphenyl)-2,5-dimethylpyrrole-3-carbaldehyde (CID 974665) is 1-(2,5-dimethoxyphenyl)-2,5-dimethylpyrrole-3-carbaldehyde.
What is the SMILES notation for 1-(2,5-dimethoxyphenyl)-2,5-dimethylpyrrole-3-carbaldehyde?
The canonical SMILES for 1-(2,5-dimethoxyphenyl)-2,5-dimethylpyrrole-3-carbaldehyde is COc1ccc(OC)c(-n2c(C)cc(C=O)c2C)c1.
What is the InChIKey of 1-(2,5-dimethoxyphenyl)-2,5-dimethylpyrrole-3-carbaldehyde?
The InChIKey is RVYUZOBWBARGQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17NO3/c1-10-7-12(9-17)11(2)16(10)14-8-13(18-3)5-6-15(14)19-4/h5-9H,1-4H3.
What are the key properties of 1-(2,5-dimethoxyphenyl)-2,5-dimethylpyrrole-3-carbaldehyde?
1-(2,5-dimethoxyphenyl)-2,5-dimethylpyrrole-3-carbaldehyde has a molecular weight of 259.31 g/mol, XLogP of 2.92, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,5-dimethoxyphenyl)-2,5-dimethylpyrrole-3-carbaldehyde is sourced from PubChem (CID 974665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).