C15H26N4O — CID 97466962
N,N-dimethyl-1-[7-[[(3S)-oxolan-3-yl]methyl]-5,6,8,9-tetrahydroimidazo[1,2-d][1,4]diazepin-3-yl]methanamine (PubChem CID 97466962) has the molecular formula C15H26N4O and a molecular weight of 278.40 g/mol. Its IUPAC name is N,N-dimethyl-1-[7-[[(3S)-oxolan-3-yl]methyl]-5,6,8,9-tetrahydroimidazo[1,2-d][1,4]diazepin-3-yl]methanamine.
| Compound Name | N,N-dimethyl-1-[7-[[(3S)-oxolan-3-yl]methyl]-5,6,8,9-tetrahydroimidazo[1,2-d][1,4]diazepin-3-yl]methanamine |
|---|---|
| PubChem CID | 97466962 |
| Molecular Formula | C15H26N4O |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.21 |
| IUPAC Name | N,N-dimethyl-1-[7-[[(3S)-oxolan-3-yl]methyl]-5,6,8,9-tetrahydroimidazo[1,2-d][1,4]diazepin-3-yl]methanamine |
| SMILES | CN(C)Cc1cnc2n1CCN(C[C@@H]1CCOC1)CC2 |
| InChI | InChI=1S/C15H26N4O/c1-17(2)11-14-9-16-15-3-5-18(6-7-19(14)15)10-13-4-8-20-12-13/h9,13H,3-8,10-12H2,1-2H3/t13-/m0/s1 |
| InChIKey | GTPIUPYBZBJXOC-ZDUSSCGKSA-N |
| XLogP | 0.84 |
| TPSA | 33.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |