C17H27N5S — CID 97466987
N-methyl-N-[[7-[(2-methyl-1,3-thiazol-4-yl)methyl]-5,6,8,9-tetrahydroimidazo[1,2-d][1,4]diazepin-3-yl]methyl]propan-2-amine (PubChem CID 97466987) has the molecular formula C17H27N5S and a molecular weight of 333.51 g/mol. Its IUPAC name is N-methyl-N-[[7-[(2-methyl-1,3-thiazol-4-yl)methyl]-5,6,8,9-tetrahydroimidazo[1,2-d][1,4]diazepin-3-yl]methyl]propan-2-amine.
| Compound Name | N-methyl-N-[[7-[(2-methyl-1,3-thiazol-4-yl)methyl]-5,6,8,9-tetrahydroimidazo[1,2-d][1,4]diazepin-3-yl]methyl]propan-2-amine |
|---|---|
| PubChem CID | 97466987 |
| Molecular Formula | C17H27N5S |
| Molecular Weight | 333.51 g/mol |
| Exact Mass | 333.20 |
| IUPAC Name | N-methyl-N-[[7-[(2-methyl-1,3-thiazol-4-yl)methyl]-5,6,8,9-tetrahydroimidazo[1,2-d][1,4]diazepin-3-yl]methyl]propan-2-amine |
| SMILES | Cc1nc(CN2CCc3ncc(CN(C)C(C)C)n3CC2)cs1 |
| InChI | InChI=1S/C17H27N5S/c1-13(2)20(4)11-16-9-18-17-5-6-21(7-8-22(16)17)10-15-12-23-14(3)19-15/h9,12-13H,5-8,10-11H2,1-4H3 |
| InChIKey | LWEVULXNHZQLKG-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 37.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.51 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |