C18H24N4OS — CID 97467204
N-[[7-(thiophen-3-ylmethyl)-5,6,8,9-tetrahydroimidazo[1,2-d][1,4]diazepin-3-yl]methyl]cyclobutanecarboxamide (PubChem CID 97467204) has the molecular formula C18H24N4OS and a molecular weight of 344.48 g/mol. Its IUPAC name is N-[[7-(thiophen-3-ylmethyl)-5,6,8,9-tetrahydroimidazo[1,2-d][1,4]diazepin-3-yl]methyl]cyclobutanecarboxamide.
| Compound Name | N-[[7-(thiophen-3-ylmethyl)-5,6,8,9-tetrahydroimidazo[1,2-d][1,4]diazepin-3-yl]methyl]cyclobutanecarboxamide |
|---|---|
| PubChem CID | 97467204 |
| Molecular Formula | C18H24N4OS |
| Molecular Weight | 344.48 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | N-[[7-(thiophen-3-ylmethyl)-5,6,8,9-tetrahydroimidazo[1,2-d][1,4]diazepin-3-yl]methyl]cyclobutanecarboxamide |
| SMILES | O=C(NCc1cnc2n1CCN(Cc1ccsc1)CC2)C1CCC1 |
| InChI | InChI=1S/C18H24N4OS/c23-18(15-2-1-3-15)20-11-16-10-19-17-4-6-21(7-8-22(16)17)12-14-5-9-24-13-14/h5,9-10,13,15H,1-4,6-8,11-12H2,(H,20,23) |
| InChIKey | SHSXQQZOZICKBJ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.48 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |