C14H19N7O2 — CID 97467232
3-[[(1-methylimidazole-2-carbonyl)amino]methyl]-5,6,8,9-tetrahydroimidazo[1,2-d][1,4]diazepine-7-carboxamide (PubChem CID 97467232) has the molecular formula C14H19N7O2 and a molecular weight of 317.35 g/mol. Its IUPAC name is 3-[[(1-methylimidazole-2-carbonyl)amino]methyl]-5,6,8,9-tetrahydroimidazo[1,2-d][1,4]diazepine-7-carboxamide.
| Compound Name | 3-[[(1-methylimidazole-2-carbonyl)amino]methyl]-5,6,8,9-tetrahydroimidazo[1,2-d][1,4]diazepine-7-carboxamide |
|---|---|
| PubChem CID | 97467232 |
| Molecular Formula | C14H19N7O2 |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | 3-[[(1-methylimidazole-2-carbonyl)amino]methyl]-5,6,8,9-tetrahydroimidazo[1,2-d][1,4]diazepine-7-carboxamide |
| SMILES | Cn1ccnc1C(=O)NCc1cnc2n1CCN(C(N)=O)CC2 |
| InChI | InChI=1S/C14H19N7O2/c1-19-5-3-16-12(19)13(22)18-9-10-8-17-11-2-4-20(14(15)23)6-7-21(10)11/h3,5,8H,2,4,6-7,9H2,1H3,(H2,15,23)(H,18,22) |
| InChIKey | VQSUZDHYYVEIII-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 111.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |