About 4-[[7-(oxan-4-yl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-2-yl]methyl]morpholine
4-[[7-(oxan-4-yl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-2-yl]methyl]morpholine (PubChem CID 97467449) has the molecular formula C16H26N4O2
and a molecular weight of 306.41 g/mol. Its IUPAC name is 4-[[7-(oxan-4-yl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-2-yl]methyl]morpholine.
Molecular Properties
| Compound Name | 4-[[7-(oxan-4-yl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-2-yl]methyl]morpholine |
| PubChem CID | 97467449 |
| Molecular Formula | C16H26N4O2 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.21 |
| IUPAC Name | 4-[[7-(oxan-4-yl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-2-yl]methyl]morpholine |
| SMILES | c1c(CN2CCOCC2)nc2n1CCN(C1CCOCC1)C2 |
| InChI | InChI=1S/C16H26N4O2/c1-7-21-8-2-15(1)19-3-4-20-12-14(17-16(20)13-19)11-18-5-9-22-10-6-18/h12,15H,1-11,13H2 |
| InChIKey | MJBGBLZPZPLSQZ-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 42.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[[7-(oxan-4-yl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-2-yl]methyl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[7-(oxan-4-yl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-2-yl]methyl]morpholine?
The IUPAC name of 4-[[7-(oxan-4-yl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-2-yl]methyl]morpholine (CID 97467449) is 4-[[7-(oxan-4-yl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-2-yl]methyl]morpholine.
What is the SMILES notation for 4-[[7-(oxan-4-yl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-2-yl]methyl]morpholine?
The canonical SMILES for 4-[[7-(oxan-4-yl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-2-yl]methyl]morpholine is c1c(CN2CCOCC2)nc2n1CCN(C1CCOCC1)C2.
What is the InChIKey of 4-[[7-(oxan-4-yl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-2-yl]methyl]morpholine?
The InChIKey is MJBGBLZPZPLSQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26N4O2/c1-7-21-8-2-15(1)19-3-4-20-12-14(17-16(20)13-19)11-18-5-9-22-10-6-18/h12,15H,1-11,13H2.
What are the key properties of 4-[[7-(oxan-4-yl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-2-yl]methyl]morpholine?
4-[[7-(oxan-4-yl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-2-yl]methyl]morpholine has a molecular weight of 306.41 g/mol, XLogP of 0.71, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[7-(oxan-4-yl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-2-yl]methyl]morpholine is sourced from PubChem (CID 97467449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).