C17H24N6O2 — CID 97467807
1-methyl-N-[(4-oxo-9-propyl-6,7,8,10-tetrahydropyrimido[1,2-a][1,4]diazepin-2-yl)methyl]imidazole-2-carboxamide (PubChem CID 97467807) has the molecular formula C17H24N6O2 and a molecular weight of 344.42 g/mol. Its IUPAC name is 1-methyl-N-[(4-oxo-9-propyl-6,7,8,10-tetrahydropyrimido[1,2-a][1,4]diazepin-2-yl)methyl]imidazole-2-carboxamide.
| Compound Name | 1-methyl-N-[(4-oxo-9-propyl-6,7,8,10-tetrahydropyrimido[1,2-a][1,4]diazepin-2-yl)methyl]imidazole-2-carboxamide |
|---|---|
| PubChem CID | 97467807 |
| Molecular Formula | C17H24N6O2 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | 1-methyl-N-[(4-oxo-9-propyl-6,7,8,10-tetrahydropyrimido[1,2-a][1,4]diazepin-2-yl)methyl]imidazole-2-carboxamide |
| SMILES | CCCN1CCCn2c(nc(CNC(=O)c3nccn3C)cc2=O)C1 |
| InChI | InChI=1S/C17H24N6O2/c1-3-6-22-7-4-8-23-14(12-22)20-13(10-15(23)24)11-19-17(25)16-18-5-9-21(16)2/h5,9-10H,3-4,6-8,11-12H2,1-2H3,(H,19,25) |
| InChIKey | ZWSHDOYDVNRBOD-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 85.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |