C17H23N5O3 — CID 97467812
5-methyl-N-[(4-oxo-9-propyl-6,7,8,10-tetrahydropyrimido[1,2-a][1,4]diazepin-2-yl)methyl]-1,2-oxazole-4-carboxamide (PubChem CID 97467812) has the molecular formula C17H23N5O3 and a molecular weight of 345.40 g/mol. Its IUPAC name is 5-methyl-N-[(4-oxo-9-propyl-6,7,8,10-tetrahydropyrimido[1,2-a][1,4]diazepin-2-yl)methyl]-1,2-oxazole-4-carboxamide.
| Compound Name | 5-methyl-N-[(4-oxo-9-propyl-6,7,8,10-tetrahydropyrimido[1,2-a][1,4]diazepin-2-yl)methyl]-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 97467812 |
| Molecular Formula | C17H23N5O3 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.18 |
| IUPAC Name | 5-methyl-N-[(4-oxo-9-propyl-6,7,8,10-tetrahydropyrimido[1,2-a][1,4]diazepin-2-yl)methyl]-1,2-oxazole-4-carboxamide |
| SMILES | CCCN1CCCn2c(nc(CNC(=O)c3cnoc3C)cc2=O)C1 |
| InChI | InChI=1S/C17H23N5O3/c1-3-5-21-6-4-7-22-15(11-21)20-13(8-16(22)23)9-18-17(24)14-10-19-25-12(14)2/h8,10H,3-7,9,11H2,1-2H3,(H,18,24) |
| InChIKey | JLOYUHISLGIHCM-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 93.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |