C15H19N5O2S — CID 97468605
[(4R)-1-ethyl-4-(prop-2-enoxymethyl)-6,7-dihydro-4H-triazolo[4,5-c]pyridin-5-yl]-(1,3-thiazol-4-yl)methanone (PubChem CID 97468605) has the molecular formula C15H19N5O2S and a molecular weight of 333.42 g/mol. Its IUPAC name is [(4R)-1-ethyl-4-(prop-2-enoxymethyl)-6,7-dihydro-4H-triazolo[4,5-c]pyridin-5-yl]-(1,3-thiazol-4-yl)methanone.
| Compound Name | [(4R)-1-ethyl-4-(prop-2-enoxymethyl)-6,7-dihydro-4H-triazolo[4,5-c]pyridin-5-yl]-(1,3-thiazol-4-yl)methanone |
|---|---|
| PubChem CID | 97468605 |
| Molecular Formula | C15H19N5O2S |
| Molecular Weight | 333.42 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | [(4R)-1-ethyl-4-(prop-2-enoxymethyl)-6,7-dihydro-4H-triazolo[4,5-c]pyridin-5-yl]-(1,3-thiazol-4-yl)methanone |
| SMILES | C=CCOC[C@H]1c2nnn(CC)c2CCN1C(=O)c1cscn1 |
| InChI | InChI=1S/C15H19N5O2S/c1-3-7-22-8-13-14-12(20(4-2)18-17-14)5-6-19(13)15(21)11-9-23-10-16-11/h3,9-10,13H,1,4-8H2,2H3/t13-/m0/s1 |
| InChIKey | KMVBYOJBHJIPFP-ZDUSSCGKSA-N |
| XLogP | 1.70 |
| TPSA | 73.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.42 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|