C17H19N5O — CID 97469532
(3S)-3-pyridin-3-yl-8-pyrimidin-2-yl-1,8-diazaspiro[4.5]decan-2-one (PubChem CID 97469532) has the molecular formula C17H19N5O and a molecular weight of 309.37 g/mol. Its IUPAC name is (3S)-3-pyridin-3-yl-8-pyrimidin-2-yl-1,8-diazaspiro[4.5]decan-2-one.
| Compound Name | (3S)-3-pyridin-3-yl-8-pyrimidin-2-yl-1,8-diazaspiro[4.5]decan-2-one |
|---|---|
| PubChem CID | 97469532 |
| Molecular Formula | C17H19N5O |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | (3S)-3-pyridin-3-yl-8-pyrimidin-2-yl-1,8-diazaspiro[4.5]decan-2-one |
| SMILES | O=C1NC2(CCN(c3ncccn3)CC2)C[C@H]1c1cccnc1 |
| InChI | InChI=1S/C17H19N5O/c23-15-14(13-3-1-6-18-12-13)11-17(21-15)4-9-22(10-5-17)16-19-7-2-8-20-16/h1-3,6-8,12,14H,4-5,9-11H2,(H,21,23)/t14-/m0/s1 |
| InChIKey | PXNRRSSKVNPYEL-AWEZNQCLSA-N |
| XLogP | 1.51 |
| TPSA | 71.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |