About cyclopentyl-[(2S,3R)-3-hydroxy-2-[(1-methylpyrazol-4-yl)methyl]pyrrolidin-1-yl]methanone
cyclopentyl-[(2S,3R)-3-hydroxy-2-[(1-methylpyrazol-4-yl)methyl]pyrrolidin-1-yl]methanone (PubChem CID 97470254) has the molecular formula C15H23N3O2
and a molecular weight of 277.37 g/mol. Its IUPAC name is cyclopentyl-[(2S,3R)-3-hydroxy-2-[(1-methylpyrazol-4-yl)methyl]pyrrolidin-1-yl]methanone.
Molecular Properties
| Compound Name | cyclopentyl-[(2S,3R)-3-hydroxy-2-[(1-methylpyrazol-4-yl)methyl]pyrrolidin-1-yl]methanone |
| PubChem CID | 97470254 |
| Molecular Formula | C15H23N3O2 |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | cyclopentyl-[(2S,3R)-3-hydroxy-2-[(1-methylpyrazol-4-yl)methyl]pyrrolidin-1-yl]methanone |
| SMILES | Cn1cc(C[C@H]2[C@H](O)CCN2C(=O)C2CCCC2)cn1 |
| InChI | InChI=1S/C15H23N3O2/c1-17-10-11(9-16-17)8-13-14(19)6-7-18(13)15(20)12-4-2-3-5-12/h9-10,12-14,19H,2-8H2,1H3/t13-,14+/m0/s1 |
| InChIKey | IOVTWASAYLOXCO-UONOGXRCSA-N |
| XLogP | 1.11 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze cyclopentyl-[(2S,3R)-3-hydroxy-2-[(1-methylpyrazol-4-yl)methyl]pyrrolidin-1-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopentyl-[(2S,3R)-3-hydroxy-2-[(1-methylpyrazol-4-yl)methyl]pyrrolidin-1-yl]methanone?
The IUPAC name of cyclopentyl-[(2S,3R)-3-hydroxy-2-[(1-methylpyrazol-4-yl)methyl]pyrrolidin-1-yl]methanone (CID 97470254) is cyclopentyl-[(2S,3R)-3-hydroxy-2-[(1-methylpyrazol-4-yl)methyl]pyrrolidin-1-yl]methanone.
What is the SMILES notation for cyclopentyl-[(2S,3R)-3-hydroxy-2-[(1-methylpyrazol-4-yl)methyl]pyrrolidin-1-yl]methanone?
The canonical SMILES for cyclopentyl-[(2S,3R)-3-hydroxy-2-[(1-methylpyrazol-4-yl)methyl]pyrrolidin-1-yl]methanone is Cn1cc(C[C@H]2[C@H](O)CCN2C(=O)C2CCCC2)cn1.
What is the InChIKey of cyclopentyl-[(2S,3R)-3-hydroxy-2-[(1-methylpyrazol-4-yl)methyl]pyrrolidin-1-yl]methanone?
The InChIKey is IOVTWASAYLOXCO-UONOGXRCSA-N. The full InChI is InChI=1S/C15H23N3O2/c1-17-10-11(9-16-17)8-13-14(19)6-7-18(13)15(20)12-4-2-3-5-12/h9-10,12-14,19H,2-8H2,1H3/t13-,14+/m0/s1.
What are the key properties of cyclopentyl-[(2S,3R)-3-hydroxy-2-[(1-methylpyrazol-4-yl)methyl]pyrrolidin-1-yl]methanone?
cyclopentyl-[(2S,3R)-3-hydroxy-2-[(1-methylpyrazol-4-yl)methyl]pyrrolidin-1-yl]methanone has a molecular weight of 277.37 g/mol, XLogP of 1.11, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopentyl-[(2S,3R)-3-hydroxy-2-[(1-methylpyrazol-4-yl)methyl]pyrrolidin-1-yl]methanone is sourced from PubChem (CID 97470254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).