C16H20N2O2 — CID 97470538
cyclopent-3-en-1-yl-[(2R,3R)-3-hydroxy-2-(pyridin-3-ylmethyl)pyrrolidin-1-yl]methanone (PubChem CID 97470538) has the molecular formula C16H20N2O2 and a molecular weight of 272.35 g/mol. Its IUPAC name is cyclopent-3-en-1-yl-[(2R,3R)-3-hydroxy-2-(pyridin-3-ylmethyl)pyrrolidin-1-yl]methanone.
| Compound Name | cyclopent-3-en-1-yl-[(2R,3R)-3-hydroxy-2-(pyridin-3-ylmethyl)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 97470538 |
| Molecular Formula | C16H20N2O2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | cyclopent-3-en-1-yl-[(2R,3R)-3-hydroxy-2-(pyridin-3-ylmethyl)pyrrolidin-1-yl]methanone |
| SMILES | O=C(C1CC=CC1)N1CC[C@@H](O)[C@H]1Cc1cccnc1 |
| InChI | InChI=1S/C16H20N2O2/c19-15-7-9-18(16(20)13-5-1-2-6-13)14(15)10-12-4-3-8-17-11-12/h1-4,8,11,13-15,19H,5-7,9-10H2/t14-,15-/m1/s1 |
| InChIKey | IKVSYUKEDIXNQU-HUUCEWRRSA-N |
| XLogP | 1.55 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|