About 3-[[(2S,3S)-3-(2-methoxyethoxy)-1-(pyridin-3-ylmethyl)pyrrolidin-2-yl]methyl]pyridine
3-[[(2S,3S)-3-(2-methoxyethoxy)-1-(pyridin-3-ylmethyl)pyrrolidin-2-yl]methyl]pyridine (PubChem CID 97470578) has the molecular formula C19H25N3O2
and a molecular weight of 327.43 g/mol. Its IUPAC name is 3-[[(2S,3S)-3-(2-methoxyethoxy)-1-(pyridin-3-ylmethyl)pyrrolidin-2-yl]methyl]pyridine.
Molecular Properties
| Compound Name | 3-[[(2S,3S)-3-(2-methoxyethoxy)-1-(pyridin-3-ylmethyl)pyrrolidin-2-yl]methyl]pyridine |
| PubChem CID | 97470578 |
| Molecular Formula | C19H25N3O2 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.19 |
| IUPAC Name | 3-[[(2S,3S)-3-(2-methoxyethoxy)-1-(pyridin-3-ylmethyl)pyrrolidin-2-yl]methyl]pyridine |
| SMILES | COCCO[C@H]1CCN(Cc2cccnc2)[C@H]1Cc1cccnc1 |
| InChI | InChI=1S/C19H25N3O2/c1-23-10-11-24-19-6-9-22(15-17-5-3-8-21-14-17)18(19)12-16-4-2-7-20-13-16/h2-5,7-8,13-14,18-19H,6,9-12,15H2,1H3/t18-,19-/m0/s1 |
| InChIKey | WCOQVDCSRPYWIA-OALUTQOASA-N |
| XLogP | 2.33 |
| TPSA | 47.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[[(2S,3S)-3-(2-methoxyethoxy)-1-(pyridin-3-ylmethyl)pyrrolidin-2-yl]methyl]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[(2S,3S)-3-(2-methoxyethoxy)-1-(pyridin-3-ylmethyl)pyrrolidin-2-yl]methyl]pyridine?
The IUPAC name of 3-[[(2S,3S)-3-(2-methoxyethoxy)-1-(pyridin-3-ylmethyl)pyrrolidin-2-yl]methyl]pyridine (CID 97470578) is 3-[[(2S,3S)-3-(2-methoxyethoxy)-1-(pyridin-3-ylmethyl)pyrrolidin-2-yl]methyl]pyridine.
What is the SMILES notation for 3-[[(2S,3S)-3-(2-methoxyethoxy)-1-(pyridin-3-ylmethyl)pyrrolidin-2-yl]methyl]pyridine?
The canonical SMILES for 3-[[(2S,3S)-3-(2-methoxyethoxy)-1-(pyridin-3-ylmethyl)pyrrolidin-2-yl]methyl]pyridine is COCCO[C@H]1CCN(Cc2cccnc2)[C@H]1Cc1cccnc1.
What is the InChIKey of 3-[[(2S,3S)-3-(2-methoxyethoxy)-1-(pyridin-3-ylmethyl)pyrrolidin-2-yl]methyl]pyridine?
The InChIKey is WCOQVDCSRPYWIA-OALUTQOASA-N. The full InChI is InChI=1S/C19H25N3O2/c1-23-10-11-24-19-6-9-22(15-17-5-3-8-21-14-17)18(19)12-16-4-2-7-20-13-16/h2-5,7-8,13-14,18-19H,6,9-12,15H2,1H3/t18-,19-/m0/s1.
What are the key properties of 3-[[(2S,3S)-3-(2-methoxyethoxy)-1-(pyridin-3-ylmethyl)pyrrolidin-2-yl]methyl]pyridine?
3-[[(2S,3S)-3-(2-methoxyethoxy)-1-(pyridin-3-ylmethyl)pyrrolidin-2-yl]methyl]pyridine has a molecular weight of 327.43 g/mol, XLogP of 2.33, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[(2S,3S)-3-(2-methoxyethoxy)-1-(pyridin-3-ylmethyl)pyrrolidin-2-yl]methyl]pyridine is sourced from PubChem (CID 97470578), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).