About (2R,3R)-3-ethoxy-N,N-dimethyl-2-[(1-methylpyrazol-4-yl)methyl]pyrrolidine-1-carboxamide
(2R,3R)-3-ethoxy-N,N-dimethyl-2-[(1-methylpyrazol-4-yl)methyl]pyrrolidine-1-carboxamide (PubChem CID 97470704) has the molecular formula C14H24N4O2
and a molecular weight of 280.37 g/mol. Its IUPAC name is (2R,3R)-3-ethoxy-N,N-dimethyl-2-[(1-methylpyrazol-4-yl)methyl]pyrrolidine-1-carboxamide.
Molecular Properties
| Compound Name | (2R,3R)-3-ethoxy-N,N-dimethyl-2-[(1-methylpyrazol-4-yl)methyl]pyrrolidine-1-carboxamide |
| PubChem CID | 97470704 |
| Molecular Formula | C14H24N4O2 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.19 |
| IUPAC Name | (2R,3R)-3-ethoxy-N,N-dimethyl-2-[(1-methylpyrazol-4-yl)methyl]pyrrolidine-1-carboxamide |
| SMILES | CCO[C@@H]1CCN(C(=O)N(C)C)[C@@H]1Cc1cnn(C)c1 |
| InChI | InChI=1S/C14H24N4O2/c1-5-20-13-6-7-18(14(19)16(2)3)12(13)8-11-9-15-17(4)10-11/h9-10,12-13H,5-8H2,1-4H3/t12-,13-/m1/s1 |
| InChIKey | SGWIICMGUDOMHQ-CHWSQXEVSA-N |
| XLogP | 1.12 |
| TPSA | 50.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2R,3R)-3-ethoxy-N,N-dimethyl-2-[(1-methylpyrazol-4-yl)methyl]pyrrolidine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,3R)-3-ethoxy-N,N-dimethyl-2-[(1-methylpyrazol-4-yl)methyl]pyrrolidine-1-carboxamide?
The IUPAC name of (2R,3R)-3-ethoxy-N,N-dimethyl-2-[(1-methylpyrazol-4-yl)methyl]pyrrolidine-1-carboxamide (CID 97470704) is (2R,3R)-3-ethoxy-N,N-dimethyl-2-[(1-methylpyrazol-4-yl)methyl]pyrrolidine-1-carboxamide.
What is the SMILES notation for (2R,3R)-3-ethoxy-N,N-dimethyl-2-[(1-methylpyrazol-4-yl)methyl]pyrrolidine-1-carboxamide?
The canonical SMILES for (2R,3R)-3-ethoxy-N,N-dimethyl-2-[(1-methylpyrazol-4-yl)methyl]pyrrolidine-1-carboxamide is CCO[C@@H]1CCN(C(=O)N(C)C)[C@@H]1Cc1cnn(C)c1.
What is the InChIKey of (2R,3R)-3-ethoxy-N,N-dimethyl-2-[(1-methylpyrazol-4-yl)methyl]pyrrolidine-1-carboxamide?
The InChIKey is SGWIICMGUDOMHQ-CHWSQXEVSA-N. The full InChI is InChI=1S/C14H24N4O2/c1-5-20-13-6-7-18(14(19)16(2)3)12(13)8-11-9-15-17(4)10-11/h9-10,12-13H,5-8H2,1-4H3/t12-,13-/m1/s1.
What are the key properties of (2R,3R)-3-ethoxy-N,N-dimethyl-2-[(1-methylpyrazol-4-yl)methyl]pyrrolidine-1-carboxamide?
(2R,3R)-3-ethoxy-N,N-dimethyl-2-[(1-methylpyrazol-4-yl)methyl]pyrrolidine-1-carboxamide has a molecular weight of 280.37 g/mol, XLogP of 1.12, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,3R)-3-ethoxy-N,N-dimethyl-2-[(1-methylpyrazol-4-yl)methyl]pyrrolidine-1-carboxamide is sourced from PubChem (CID 97470704), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).