About 4-[(2S,3R)-1-(furan-3-ylmethyl)-2-(pyridin-4-ylmethyl)pyrrolidin-3-yl]morpholine
4-[(2S,3R)-1-(furan-3-ylmethyl)-2-(pyridin-4-ylmethyl)pyrrolidin-3-yl]morpholine (PubChem CID 97471082) has the molecular formula C19H25N3O2
and a molecular weight of 327.43 g/mol. Its IUPAC name is 4-[(2S,3R)-1-(furan-3-ylmethyl)-2-(pyridin-4-ylmethyl)pyrrolidin-3-yl]morpholine.
Molecular Properties
| Compound Name | 4-[(2S,3R)-1-(furan-3-ylmethyl)-2-(pyridin-4-ylmethyl)pyrrolidin-3-yl]morpholine |
| PubChem CID | 97471082 |
| Molecular Formula | C19H25N3O2 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.19 |
| IUPAC Name | 4-[(2S,3R)-1-(furan-3-ylmethyl)-2-(pyridin-4-ylmethyl)pyrrolidin-3-yl]morpholine |
| SMILES | c1cc(C[C@H]2[C@H](N3CCOCC3)CCN2Cc2ccoc2)ccn1 |
| InChI | InChI=1S/C19H25N3O2/c1-5-20-6-2-16(1)13-19-18(21-8-11-23-12-9-21)3-7-22(19)14-17-4-10-24-15-17/h1-2,4-6,10,15,18-19H,3,7-9,11-14H2/t18-,19+/m1/s1 |
| InChIKey | SMUCDFHPSLRETG-MOPGFXCFSA-N |
| XLogP | 2.19 |
| TPSA | 41.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[(2S,3R)-1-(furan-3-ylmethyl)-2-(pyridin-4-ylmethyl)pyrrolidin-3-yl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2S,3R)-1-(furan-3-ylmethyl)-2-(pyridin-4-ylmethyl)pyrrolidin-3-yl]morpholine?
The IUPAC name of 4-[(2S,3R)-1-(furan-3-ylmethyl)-2-(pyridin-4-ylmethyl)pyrrolidin-3-yl]morpholine (CID 97471082) is 4-[(2S,3R)-1-(furan-3-ylmethyl)-2-(pyridin-4-ylmethyl)pyrrolidin-3-yl]morpholine.
What is the SMILES notation for 4-[(2S,3R)-1-(furan-3-ylmethyl)-2-(pyridin-4-ylmethyl)pyrrolidin-3-yl]morpholine?
The canonical SMILES for 4-[(2S,3R)-1-(furan-3-ylmethyl)-2-(pyridin-4-ylmethyl)pyrrolidin-3-yl]morpholine is c1cc(C[C@H]2[C@H](N3CCOCC3)CCN2Cc2ccoc2)ccn1.
What is the InChIKey of 4-[(2S,3R)-1-(furan-3-ylmethyl)-2-(pyridin-4-ylmethyl)pyrrolidin-3-yl]morpholine?
The InChIKey is SMUCDFHPSLRETG-MOPGFXCFSA-N. The full InChI is InChI=1S/C19H25N3O2/c1-5-20-6-2-16(1)13-19-18(21-8-11-23-12-9-21)3-7-22(19)14-17-4-10-24-15-17/h1-2,4-6,10,15,18-19H,3,7-9,11-14H2/t18-,19+/m1/s1.
What are the key properties of 4-[(2S,3R)-1-(furan-3-ylmethyl)-2-(pyridin-4-ylmethyl)pyrrolidin-3-yl]morpholine?
4-[(2S,3R)-1-(furan-3-ylmethyl)-2-(pyridin-4-ylmethyl)pyrrolidin-3-yl]morpholine has a molecular weight of 327.43 g/mol, XLogP of 2.19, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2S,3R)-1-(furan-3-ylmethyl)-2-(pyridin-4-ylmethyl)pyrrolidin-3-yl]morpholine is sourced from PubChem (CID 97471082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).