About 2-(3-methyl-2-pyridinyl)-7-(pyridin-3-ylmethyl)-2,7-diazaspiro[3.4]octane
2-(3-methyl-2-pyridinyl)-7-(pyridin-3-ylmethyl)-2,7-diazaspiro[3.4]octane (PubChem CID 97472522) has the molecular formula C18H22N4
and a molecular weight of 294.40 g/mol. Its IUPAC name is 2-(3-methyl-2-pyridinyl)-7-(pyridin-3-ylmethyl)-2,7-diazaspiro[3.4]octane.
Molecular Properties
| Compound Name | 2-(3-methyl-2-pyridinyl)-7-(pyridin-3-ylmethyl)-2,7-diazaspiro[3.4]octane |
| PubChem CID | 97472522 |
| Molecular Formula | C18H22N4 |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | 2-(3-methyl-2-pyridinyl)-7-(pyridin-3-ylmethyl)-2,7-diazaspiro[3.4]octane |
| SMILES | Cc1cccnc1N1CC2(CCN(Cc3cccnc3)C2)C1 |
| InChI | InChI=1S/C18H22N4/c1-15-4-2-8-20-17(15)22-13-18(14-22)6-9-21(12-18)11-16-5-3-7-19-10-16/h2-5,7-8,10H,6,9,11-14H2,1H3 |
| InChIKey | HQUZGYAFRRDBKL-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(3-methyl-2-pyridinyl)-7-(pyridin-3-ylmethyl)-2,7-diazaspiro[3.4]octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-methyl-2-pyridinyl)-7-(pyridin-3-ylmethyl)-2,7-diazaspiro[3.4]octane?
The IUPAC name of 2-(3-methyl-2-pyridinyl)-7-(pyridin-3-ylmethyl)-2,7-diazaspiro[3.4]octane (CID 97472522) is 2-(3-methyl-2-pyridinyl)-7-(pyridin-3-ylmethyl)-2,7-diazaspiro[3.4]octane.
What is the SMILES notation for 2-(3-methyl-2-pyridinyl)-7-(pyridin-3-ylmethyl)-2,7-diazaspiro[3.4]octane?
The canonical SMILES for 2-(3-methyl-2-pyridinyl)-7-(pyridin-3-ylmethyl)-2,7-diazaspiro[3.4]octane is Cc1cccnc1N1CC2(CCN(Cc3cccnc3)C2)C1.
What is the InChIKey of 2-(3-methyl-2-pyridinyl)-7-(pyridin-3-ylmethyl)-2,7-diazaspiro[3.4]octane?
The InChIKey is HQUZGYAFRRDBKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22N4/c1-15-4-2-8-20-17(15)22-13-18(14-22)6-9-21(12-18)11-16-5-3-7-19-10-16/h2-5,7-8,10H,6,9,11-14H2,1H3.
What are the key properties of 2-(3-methyl-2-pyridinyl)-7-(pyridin-3-ylmethyl)-2,7-diazaspiro[3.4]octane?
2-(3-methyl-2-pyridinyl)-7-(pyridin-3-ylmethyl)-2,7-diazaspiro[3.4]octane has a molecular weight of 294.40 g/mol, XLogP of 2.50, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-methyl-2-pyridinyl)-7-(pyridin-3-ylmethyl)-2,7-diazaspiro[3.4]octane is sourced from PubChem (CID 97472522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).