About 2-cyclopropylsulfonyl-7-(5-methylpyrimidin-2-yl)-2,7-diazaspiro[3.4]octane
2-cyclopropylsulfonyl-7-(5-methylpyrimidin-2-yl)-2,7-diazaspiro[3.4]octane (PubChem CID 97472792) has the molecular formula C14H20N4O2S
and a molecular weight of 308.41 g/mol. Its IUPAC name is 2-cyclopropylsulfonyl-7-(5-methylpyrimidin-2-yl)-2,7-diazaspiro[3.4]octane.
Molecular Properties
| Compound Name | 2-cyclopropylsulfonyl-7-(5-methylpyrimidin-2-yl)-2,7-diazaspiro[3.4]octane |
| PubChem CID | 97472792 |
| Molecular Formula | C14H20N4O2S |
| Molecular Weight | 308.41 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | 2-cyclopropylsulfonyl-7-(5-methylpyrimidin-2-yl)-2,7-diazaspiro[3.4]octane |
| SMILES | Cc1cnc(N2CCC3(C2)CN(S(=O)(=O)C2CC2)C3)nc1 |
| InChI | InChI=1S/C14H20N4O2S/c1-11-6-15-13(16-7-11)17-5-4-14(8-17)9-18(10-14)21(19,20)12-2-3-12/h6-7,12H,2-5,8-10H2,1H3 |
| InChIKey | TVKFEYKIAIXDGQ-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.41 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-cyclopropylsulfonyl-7-(5-methylpyrimidin-2-yl)-2,7-diazaspiro[3.4]octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopropylsulfonyl-7-(5-methylpyrimidin-2-yl)-2,7-diazaspiro[3.4]octane?
The IUPAC name of 2-cyclopropylsulfonyl-7-(5-methylpyrimidin-2-yl)-2,7-diazaspiro[3.4]octane (CID 97472792) is 2-cyclopropylsulfonyl-7-(5-methylpyrimidin-2-yl)-2,7-diazaspiro[3.4]octane.
What is the SMILES notation for 2-cyclopropylsulfonyl-7-(5-methylpyrimidin-2-yl)-2,7-diazaspiro[3.4]octane?
The canonical SMILES for 2-cyclopropylsulfonyl-7-(5-methylpyrimidin-2-yl)-2,7-diazaspiro[3.4]octane is Cc1cnc(N2CCC3(C2)CN(S(=O)(=O)C2CC2)C3)nc1.
What is the InChIKey of 2-cyclopropylsulfonyl-7-(5-methylpyrimidin-2-yl)-2,7-diazaspiro[3.4]octane?
The InChIKey is TVKFEYKIAIXDGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N4O2S/c1-11-6-15-13(16-7-11)17-5-4-14(8-17)9-18(10-14)21(19,20)12-2-3-12/h6-7,12H,2-5,8-10H2,1H3.
What are the key properties of 2-cyclopropylsulfonyl-7-(5-methylpyrimidin-2-yl)-2,7-diazaspiro[3.4]octane?
2-cyclopropylsulfonyl-7-(5-methylpyrimidin-2-yl)-2,7-diazaspiro[3.4]octane has a molecular weight of 308.41 g/mol, XLogP of 0.79, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopropylsulfonyl-7-(5-methylpyrimidin-2-yl)-2,7-diazaspiro[3.4]octane is sourced from PubChem (CID 97472792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).