C16H21FN2O3S — CID 97472958
2-(3-fluorophenyl)-7-propylsulfonyl-2,7-diazaspiro[3.5]nonan-3-one (PubChem CID 97472958) has the molecular formula C16H21FN2O3S and a molecular weight of 340.42 g/mol. Its IUPAC name is 2-(3-fluorophenyl)-7-propylsulfonyl-2,7-diazaspiro[3.5]nonan-3-one.
| Compound Name | 2-(3-fluorophenyl)-7-propylsulfonyl-2,7-diazaspiro[3.5]nonan-3-one |
|---|---|
| PubChem CID | 97472958 |
| Molecular Formula | C16H21FN2O3S |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | 2-(3-fluorophenyl)-7-propylsulfonyl-2,7-diazaspiro[3.5]nonan-3-one |
| SMILES | CCCS(=O)(=O)N1CCC2(CC1)CN(c1cccc(F)c1)C2=O |
| InChI | InChI=1S/C16H21FN2O3S/c1-2-10-23(21,22)18-8-6-16(7-9-18)12-19(15(16)20)14-5-3-4-13(17)11-14/h3-5,11H,2,6-10,12H2,1H3 |
| InChIKey | YQBDYRNGZVRXOF-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |