About (5R)-7-(benzenesulfonyl)-1-[(5-methylfuran-2-yl)methyl]-1,7-diazaspiro[4.4]nonane
(5R)-7-(benzenesulfonyl)-1-[(5-methylfuran-2-yl)methyl]-1,7-diazaspiro[4.4]nonane (PubChem CID 97473106) has the molecular formula C19H24N2O3S
and a molecular weight of 360.48 g/mol. Its IUPAC name is (5R)-7-(benzenesulfonyl)-1-[(5-methylfuran-2-yl)methyl]-1,7-diazaspiro[4.4]nonane.
Molecular Properties
| Compound Name | (5R)-7-(benzenesulfonyl)-1-[(5-methylfuran-2-yl)methyl]-1,7-diazaspiro[4.4]nonane |
| PubChem CID | 97473106 |
| Molecular Formula | C19H24N2O3S |
| Molecular Weight | 360.48 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | (5R)-7-(benzenesulfonyl)-1-[(5-methylfuran-2-yl)methyl]-1,7-diazaspiro[4.4]nonane |
| SMILES | Cc1ccc(CN2CCC[C@]23CCN(S(=O)(=O)c2ccccc2)C3)o1 |
| InChI | InChI=1S/C19H24N2O3S/c1-16-8-9-17(24-16)14-20-12-5-10-19(20)11-13-21(15-19)25(22,23)18-6-3-2-4-7-18/h2-4,6-9H,5,10-15H2,1H3/t19-/m1/s1 |
| InChIKey | BXFNTASPYBLHDX-LJQANCHMSA-N |
| XLogP | 3.02 |
| TPSA | 53.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.48 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (5R)-7-(benzenesulfonyl)-1-[(5-methylfuran-2-yl)methyl]-1,7-diazaspiro[4.4]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R)-7-(benzenesulfonyl)-1-[(5-methylfuran-2-yl)methyl]-1,7-diazaspiro[4.4]nonane?
The IUPAC name of (5R)-7-(benzenesulfonyl)-1-[(5-methylfuran-2-yl)methyl]-1,7-diazaspiro[4.4]nonane (CID 97473106) is (5R)-7-(benzenesulfonyl)-1-[(5-methylfuran-2-yl)methyl]-1,7-diazaspiro[4.4]nonane.
What is the SMILES notation for (5R)-7-(benzenesulfonyl)-1-[(5-methylfuran-2-yl)methyl]-1,7-diazaspiro[4.4]nonane?
The canonical SMILES for (5R)-7-(benzenesulfonyl)-1-[(5-methylfuran-2-yl)methyl]-1,7-diazaspiro[4.4]nonane is Cc1ccc(CN2CCC[C@]23CCN(S(=O)(=O)c2ccccc2)C3)o1.
What is the InChIKey of (5R)-7-(benzenesulfonyl)-1-[(5-methylfuran-2-yl)methyl]-1,7-diazaspiro[4.4]nonane?
The InChIKey is BXFNTASPYBLHDX-LJQANCHMSA-N. The full InChI is InChI=1S/C19H24N2O3S/c1-16-8-9-17(24-16)14-20-12-5-10-19(20)11-13-21(15-19)25(22,23)18-6-3-2-4-7-18/h2-4,6-9H,5,10-15H2,1H3/t19-/m1/s1.
What are the key properties of (5R)-7-(benzenesulfonyl)-1-[(5-methylfuran-2-yl)methyl]-1,7-diazaspiro[4.4]nonane?
(5R)-7-(benzenesulfonyl)-1-[(5-methylfuran-2-yl)methyl]-1,7-diazaspiro[4.4]nonane has a molecular weight of 360.48 g/mol, XLogP of 3.02, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5R)-7-(benzenesulfonyl)-1-[(5-methylfuran-2-yl)methyl]-1,7-diazaspiro[4.4]nonane is sourced from PubChem (CID 97473106), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).