C17H24N4O2 — CID 97474017
[(5aS,8aS)-4-(cyclopropylmethyl)-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepin-7-yl]-(5-methylpyrazin-2-yl)methanone (PubChem CID 97474017) has the molecular formula C17H24N4O2 and a molecular weight of 316.40 g/mol. Its IUPAC name is [(5aS,8aS)-4-(cyclopropylmethyl)-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepin-7-yl]-(5-methylpyrazin-2-yl)methanone.
| Compound Name | [(5aS,8aS)-4-(cyclopropylmethyl)-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepin-7-yl]-(5-methylpyrazin-2-yl)methanone |
|---|---|
| PubChem CID | 97474017 |
| Molecular Formula | C17H24N4O2 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | [(5aS,8aS)-4-(cyclopropylmethyl)-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepin-7-yl]-(5-methylpyrazin-2-yl)methanone |
| SMILES | Cc1cnc(C(=O)N2C[C@@H]3CN(CC4CC4)CCO[C@@H]3C2)cn1 |
| InChI | InChI=1S/C17H24N4O2/c1-12-6-19-15(7-18-12)17(22)21-10-14-9-20(8-13-2-3-13)4-5-23-16(14)11-21/h6-7,13-14,16H,2-5,8-11H2,1H3/t14-,16+/m0/s1 |
| InChIKey | DNZOGCACNHGCNY-GOEBONIOSA-N |
| XLogP | 0.97 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |