C14H21N3O2S — CID 97474538
(3aR,6aR)-N,N-dimethyl-5-[(4-methyl-1,3-thiazol-2-yl)methyl]-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole-3a-carboxamide (PubChem CID 97474538) has the molecular formula C14H21N3O2S and a molecular weight of 295.41 g/mol. Its IUPAC name is (3aR,6aR)-N,N-dimethyl-5-[(4-methyl-1,3-thiazol-2-yl)methyl]-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole-3a-carboxamide.
| Compound Name | (3aR,6aR)-N,N-dimethyl-5-[(4-methyl-1,3-thiazol-2-yl)methyl]-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole-3a-carboxamide |
|---|---|
| PubChem CID | 97474538 |
| Molecular Formula | C14H21N3O2S |
| Molecular Weight | 295.41 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | (3aR,6aR)-N,N-dimethyl-5-[(4-methyl-1,3-thiazol-2-yl)methyl]-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole-3a-carboxamide |
| SMILES | Cc1csc(CN2C[C@@H]3COC[C@]3(C(=O)N(C)C)C2)n1 |
| InChI | InChI=1S/C14H21N3O2S/c1-10-7-20-12(15-10)5-17-4-11-6-19-9-14(11,8-17)13(18)16(2)3/h7,11H,4-6,8-9H2,1-3H3/t11-,14-/m1/s1 |
| InChIKey | QRFNNNACIGIULE-BXUZGUMPSA-N |
| XLogP | 0.99 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.41 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |