About 1-[(5R,9R)-2-cyclopropylsulfonyl-6-oxa-2-azaspiro[4.5]decan-9-yl]pyrrolidin-2-one
1-[(5R,9R)-2-cyclopropylsulfonyl-6-oxa-2-azaspiro[4.5]decan-9-yl]pyrrolidin-2-one (PubChem CID 97474925) has the molecular formula C15H24N2O4S
and a molecular weight of 328.43 g/mol. Its IUPAC name is 1-[(5R,9R)-2-cyclopropylsulfonyl-6-oxa-2-azaspiro[4.5]decan-9-yl]pyrrolidin-2-one.
Molecular Properties
| Compound Name | 1-[(5R,9R)-2-cyclopropylsulfonyl-6-oxa-2-azaspiro[4.5]decan-9-yl]pyrrolidin-2-one |
| PubChem CID | 97474925 |
| Molecular Formula | C15H24N2O4S |
| Molecular Weight | 328.43 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | 1-[(5R,9R)-2-cyclopropylsulfonyl-6-oxa-2-azaspiro[4.5]decan-9-yl]pyrrolidin-2-one |
| SMILES | O=C1CCCN1[C@@H]1CCO[C@]2(CCN(S(=O)(=O)C3CC3)C2)C1 |
| InChI | InChI=1S/C15H24N2O4S/c18-14-2-1-7-17(14)12-5-9-21-15(10-12)6-8-16(11-15)22(19,20)13-3-4-13/h12-13H,1-11H2/t12-,15-/m1/s1 |
| InChIKey | ZCDVMMGTUVGDKA-IUODEOHRSA-N |
| XLogP | 0.72 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.43 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[(5R,9R)-2-cyclopropylsulfonyl-6-oxa-2-azaspiro[4.5]decan-9-yl]pyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(5R,9R)-2-cyclopropylsulfonyl-6-oxa-2-azaspiro[4.5]decan-9-yl]pyrrolidin-2-one?
The IUPAC name of 1-[(5R,9R)-2-cyclopropylsulfonyl-6-oxa-2-azaspiro[4.5]decan-9-yl]pyrrolidin-2-one (CID 97474925) is 1-[(5R,9R)-2-cyclopropylsulfonyl-6-oxa-2-azaspiro[4.5]decan-9-yl]pyrrolidin-2-one.
What is the SMILES notation for 1-[(5R,9R)-2-cyclopropylsulfonyl-6-oxa-2-azaspiro[4.5]decan-9-yl]pyrrolidin-2-one?
The canonical SMILES for 1-[(5R,9R)-2-cyclopropylsulfonyl-6-oxa-2-azaspiro[4.5]decan-9-yl]pyrrolidin-2-one is O=C1CCCN1[C@@H]1CCO[C@]2(CCN(S(=O)(=O)C3CC3)C2)C1.
What is the InChIKey of 1-[(5R,9R)-2-cyclopropylsulfonyl-6-oxa-2-azaspiro[4.5]decan-9-yl]pyrrolidin-2-one?
The InChIKey is ZCDVMMGTUVGDKA-IUODEOHRSA-N. The full InChI is InChI=1S/C15H24N2O4S/c18-14-2-1-7-17(14)12-5-9-21-15(10-12)6-8-16(11-15)22(19,20)13-3-4-13/h12-13H,1-11H2/t12-,15-/m1/s1.
What are the key properties of 1-[(5R,9R)-2-cyclopropylsulfonyl-6-oxa-2-azaspiro[4.5]decan-9-yl]pyrrolidin-2-one?
1-[(5R,9R)-2-cyclopropylsulfonyl-6-oxa-2-azaspiro[4.5]decan-9-yl]pyrrolidin-2-one has a molecular weight of 328.43 g/mol, XLogP of 0.72, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(5R,9R)-2-cyclopropylsulfonyl-6-oxa-2-azaspiro[4.5]decan-9-yl]pyrrolidin-2-one is sourced from PubChem (CID 97474925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).