C17H25N3O2S — CID 97475102
2-[(3aS,6aR)-5-[(4-methyl-1,3-thiazol-2-yl)methyl]-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrol-3a-yl]-N-(cyclopropylmethyl)acetamide (PubChem CID 97475102) has the molecular formula C17H25N3O2S and a molecular weight of 335.47 g/mol. Its IUPAC name is 2-[(3aS,6aR)-5-[(4-methyl-1,3-thiazol-2-yl)methyl]-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrol-3a-yl]-N-(cyclopropylmethyl)acetamide.
| Compound Name | 2-[(3aS,6aR)-5-[(4-methyl-1,3-thiazol-2-yl)methyl]-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrol-3a-yl]-N-(cyclopropylmethyl)acetamide |
|---|---|
| PubChem CID | 97475102 |
| Molecular Formula | C17H25N3O2S |
| Molecular Weight | 335.47 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | 2-[(3aS,6aR)-5-[(4-methyl-1,3-thiazol-2-yl)methyl]-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrol-3a-yl]-N-(cyclopropylmethyl)acetamide |
| SMILES | Cc1csc(CN2C[C@@H]3COC[C@]3(CC(=O)NCC3CC3)C2)n1 |
| InChI | InChI=1S/C17H25N3O2S/c1-12-9-23-16(19-12)7-20-6-14-8-22-11-17(14,10-20)4-15(21)18-5-13-2-3-13/h9,13-14H,2-8,10-11H2,1H3,(H,18,21)/t14-,17+/m1/s1 |
| InChIKey | PJGLDDVXSXGQOZ-PBHICJAKSA-N |
| XLogP | 1.82 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.47 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |