About N-[[(5R,7S)-2-propanoyl-6-oxa-2-azaspiro[4.5]decan-7-yl]methyl]methanesulfonamide
N-[[(5R,7S)-2-propanoyl-6-oxa-2-azaspiro[4.5]decan-7-yl]methyl]methanesulfonamide (PubChem CID 97475258) has the molecular formula C13H24N2O4S
and a molecular weight of 304.41 g/mol. Its IUPAC name is N-[[(5R,7S)-2-propanoyl-6-oxa-2-azaspiro[4.5]decan-7-yl]methyl]methanesulfonamide.
Molecular Properties
| Compound Name | N-[[(5R,7S)-2-propanoyl-6-oxa-2-azaspiro[4.5]decan-7-yl]methyl]methanesulfonamide |
| PubChem CID | 97475258 |
| Molecular Formula | C13H24N2O4S |
| Molecular Weight | 304.41 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | N-[[(5R,7S)-2-propanoyl-6-oxa-2-azaspiro[4.5]decan-7-yl]methyl]methanesulfonamide |
| SMILES | CCC(=O)N1CC[C@]2(CCC[C@@H](CNS(C)(=O)=O)O2)C1 |
| InChI | InChI=1S/C13H24N2O4S/c1-3-12(16)15-8-7-13(10-15)6-4-5-11(19-13)9-14-20(2,17)18/h11,14H,3-10H2,1-2H3/t11-,13+/m0/s1 |
| InChIKey | RXMIIPKXAQROIJ-WCQYABFASA-N |
| XLogP | 0.49 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.41 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[[(5R,7S)-2-propanoyl-6-oxa-2-azaspiro[4.5]decan-7-yl]methyl]methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[(5R,7S)-2-propanoyl-6-oxa-2-azaspiro[4.5]decan-7-yl]methyl]methanesulfonamide?
The IUPAC name of N-[[(5R,7S)-2-propanoyl-6-oxa-2-azaspiro[4.5]decan-7-yl]methyl]methanesulfonamide (CID 97475258) is N-[[(5R,7S)-2-propanoyl-6-oxa-2-azaspiro[4.5]decan-7-yl]methyl]methanesulfonamide.
What is the SMILES notation for N-[[(5R,7S)-2-propanoyl-6-oxa-2-azaspiro[4.5]decan-7-yl]methyl]methanesulfonamide?
The canonical SMILES for N-[[(5R,7S)-2-propanoyl-6-oxa-2-azaspiro[4.5]decan-7-yl]methyl]methanesulfonamide is CCC(=O)N1CC[C@]2(CCC[C@@H](CNS(C)(=O)=O)O2)C1.
What is the InChIKey of N-[[(5R,7S)-2-propanoyl-6-oxa-2-azaspiro[4.5]decan-7-yl]methyl]methanesulfonamide?
The InChIKey is RXMIIPKXAQROIJ-WCQYABFASA-N. The full InChI is InChI=1S/C13H24N2O4S/c1-3-12(16)15-8-7-13(10-15)6-4-5-11(19-13)9-14-20(2,17)18/h11,14H,3-10H2,1-2H3/t11-,13+/m0/s1.
What are the key properties of N-[[(5R,7S)-2-propanoyl-6-oxa-2-azaspiro[4.5]decan-7-yl]methyl]methanesulfonamide?
N-[[(5R,7S)-2-propanoyl-6-oxa-2-azaspiro[4.5]decan-7-yl]methyl]methanesulfonamide has a molecular weight of 304.41 g/mol, XLogP of 0.49, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[(5R,7S)-2-propanoyl-6-oxa-2-azaspiro[4.5]decan-7-yl]methyl]methanesulfonamide is sourced from PubChem (CID 97475258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).