C14H18N4O3 — CID 97475308
[(6R)-6-(methoxymethyl)-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepin-8-yl]-(3-methyl-1,2-oxazol-5-yl)methanone (PubChem CID 97475308) has the molecular formula C14H18N4O3 and a molecular weight of 290.32 g/mol. Its IUPAC name is [(6R)-6-(methoxymethyl)-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepin-8-yl]-(3-methyl-1,2-oxazol-5-yl)methanone.
| Compound Name | [(6R)-6-(methoxymethyl)-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepin-8-yl]-(3-methyl-1,2-oxazol-5-yl)methanone |
|---|---|
| PubChem CID | 97475308 |
| Molecular Formula | C14H18N4O3 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | [(6R)-6-(methoxymethyl)-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepin-8-yl]-(3-methyl-1,2-oxazol-5-yl)methanone |
| SMILES | COC[C@H]1CN(C(=O)c2cc(C)no2)Cc2cncn2C1 |
| InChI | InChI=1S/C14H18N4O3/c1-10-3-13(21-16-10)14(19)17-5-11(8-20-2)6-18-9-15-4-12(18)7-17/h3-4,9,11H,5-8H2,1-2H3/t11-/m0/s1 |
| InChIKey | LAIJNEJGWNYEEN-NSHDSACASA-N |
| XLogP | 1.10 |
| TPSA | 73.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |