About (5R,9S)-N,N-dimethyl-9-(2-oxopyrrolidin-1-yl)-6-oxa-2-azaspiro[4.5]decane-2-carboxamide
(5R,9S)-N,N-dimethyl-9-(2-oxopyrrolidin-1-yl)-6-oxa-2-azaspiro[4.5]decane-2-carboxamide (PubChem CID 97475313) has the molecular formula C15H25N3O3
and a molecular weight of 295.38 g/mol. Its IUPAC name is (5R,9S)-N,N-dimethyl-9-(2-oxopyrrolidin-1-yl)-6-oxa-2-azaspiro[4.5]decane-2-carboxamide.
Molecular Properties
| Compound Name | (5R,9S)-N,N-dimethyl-9-(2-oxopyrrolidin-1-yl)-6-oxa-2-azaspiro[4.5]decane-2-carboxamide |
| PubChem CID | 97475313 |
| Molecular Formula | C15H25N3O3 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | (5R,9S)-N,N-dimethyl-9-(2-oxopyrrolidin-1-yl)-6-oxa-2-azaspiro[4.5]decane-2-carboxamide |
| SMILES | CN(C)C(=O)N1CC[C@@]2(C[C@@H](N3CCCC3=O)CCO2)C1 |
| InChI | InChI=1S/C15H25N3O3/c1-16(2)14(20)17-8-6-15(11-17)10-12(5-9-21-15)18-7-3-4-13(18)19/h12H,3-11H2,1-2H3/t12-,15+/m0/s1 |
| InChIKey | JUKHBNAILXBDHD-SWLSCSKDSA-N |
| XLogP | 0.91 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (5R,9S)-N,N-dimethyl-9-(2-oxopyrrolidin-1-yl)-6-oxa-2-azaspiro[4.5]decane-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R,9S)-N,N-dimethyl-9-(2-oxopyrrolidin-1-yl)-6-oxa-2-azaspiro[4.5]decane-2-carboxamide?
The IUPAC name of (5R,9S)-N,N-dimethyl-9-(2-oxopyrrolidin-1-yl)-6-oxa-2-azaspiro[4.5]decane-2-carboxamide (CID 97475313) is (5R,9S)-N,N-dimethyl-9-(2-oxopyrrolidin-1-yl)-6-oxa-2-azaspiro[4.5]decane-2-carboxamide.
What is the SMILES notation for (5R,9S)-N,N-dimethyl-9-(2-oxopyrrolidin-1-yl)-6-oxa-2-azaspiro[4.5]decane-2-carboxamide?
The canonical SMILES for (5R,9S)-N,N-dimethyl-9-(2-oxopyrrolidin-1-yl)-6-oxa-2-azaspiro[4.5]decane-2-carboxamide is CN(C)C(=O)N1CC[C@@]2(C[C@@H](N3CCCC3=O)CCO2)C1.
What is the InChIKey of (5R,9S)-N,N-dimethyl-9-(2-oxopyrrolidin-1-yl)-6-oxa-2-azaspiro[4.5]decane-2-carboxamide?
The InChIKey is JUKHBNAILXBDHD-SWLSCSKDSA-N. The full InChI is InChI=1S/C15H25N3O3/c1-16(2)14(20)17-8-6-15(11-17)10-12(5-9-21-15)18-7-3-4-13(18)19/h12H,3-11H2,1-2H3/t12-,15+/m0/s1.
What are the key properties of (5R,9S)-N,N-dimethyl-9-(2-oxopyrrolidin-1-yl)-6-oxa-2-azaspiro[4.5]decane-2-carboxamide?
(5R,9S)-N,N-dimethyl-9-(2-oxopyrrolidin-1-yl)-6-oxa-2-azaspiro[4.5]decane-2-carboxamide has a molecular weight of 295.38 g/mol, XLogP of 0.91, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5R,9S)-N,N-dimethyl-9-(2-oxopyrrolidin-1-yl)-6-oxa-2-azaspiro[4.5]decane-2-carboxamide is sourced from PubChem (CID 97475313), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).