C14H19N3O2 — CID 97475761
[(1S,3aR,7aR)-1-ethyl-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-5-yl]-pyrimidin-2-ylmethanone (PubChem CID 97475761) has the molecular formula C14H19N3O2 and a molecular weight of 261.32 g/mol. Its IUPAC name is [(1S,3aR,7aR)-1-ethyl-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-5-yl]-pyrimidin-2-ylmethanone.
| Compound Name | [(1S,3aR,7aR)-1-ethyl-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-5-yl]-pyrimidin-2-ylmethanone |
|---|---|
| PubChem CID | 97475761 |
| Molecular Formula | C14H19N3O2 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | [(1S,3aR,7aR)-1-ethyl-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-5-yl]-pyrimidin-2-ylmethanone |
| SMILES | CC[C@@H]1OC[C@H]2CN(C(=O)c3ncccn3)CC[C@H]21 |
| InChI | InChI=1S/C14H19N3O2/c1-2-12-11-4-7-17(8-10(11)9-19-12)14(18)13-15-5-3-6-16-13/h3,5-6,10-12H,2,4,7-9H2,1H3/t10-,11-,12+/m1/s1 |
| InChIKey | CEFQLMYSYCOCCB-UTUOFQBUSA-N |
| XLogP | 1.36 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |