C17H24FN5O2 — CID 97476302
2-[(2R,3aS,6aS)-5-(5-fluoropyrimidin-2-yl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-2-yl]-1-(4-methylpiperazin-1-yl)ethanone (PubChem CID 97476302) has the molecular formula C17H24FN5O2 and a molecular weight of 349.41 g/mol. Its IUPAC name is 2-[(2R,3aS,6aS)-5-(5-fluoropyrimidin-2-yl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-2-yl]-1-(4-methylpiperazin-1-yl)ethanone.
| Compound Name | 2-[(2R,3aS,6aS)-5-(5-fluoropyrimidin-2-yl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-2-yl]-1-(4-methylpiperazin-1-yl)ethanone |
|---|---|
| PubChem CID | 97476302 |
| Molecular Formula | C17H24FN5O2 |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.19 |
| IUPAC Name | 2-[(2R,3aS,6aS)-5-(5-fluoropyrimidin-2-yl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-2-yl]-1-(4-methylpiperazin-1-yl)ethanone |
| SMILES | CN1CCN(C(=O)C[C@H]2C[C@H]3CN(c4ncc(F)cn4)C[C@H]3O2)CC1 |
| InChI | InChI=1S/C17H24FN5O2/c1-21-2-4-22(5-3-21)16(24)7-14-6-12-10-23(11-15(12)25-14)17-19-8-13(18)9-20-17/h8-9,12,14-15H,2-7,10-11H2,1H3/t12-,14+,15+/m0/s1 |
| InChIKey | SJJAPZGREFWCIV-NWANDNLSSA-N |
| XLogP | 0.37 |
| TPSA | 61.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |